C18H19F3N6S — CID 53353238
1-(3-methyl-1,2,4-thiadiazol-5-yl)-N-[1-[(3,4,5-trifluorophenyl)methyl]pyrazol-3-yl]piperidin-4-amine (PubChem CID 53353238) has the molecular formula C18H19F3N6S and a molecular weight of 408.45 g/mol. Its IUPAC name is 1-(3-methyl-1,2,4-thiadiazol-5-yl)-N-[1-[(3,4,5-trifluorophenyl)methyl]pyrazol-3-yl]piperidin-4-amine.
| Compound Name | 1-(3-methyl-1,2,4-thiadiazol-5-yl)-N-[1-[(3,4,5-trifluorophenyl)methyl]pyrazol-3-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 53353238 |
| Molecular Formula | C18H19F3N6S |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 1-(3-methyl-1,2,4-thiadiazol-5-yl)-N-[1-[(3,4,5-trifluorophenyl)methyl]pyrazol-3-yl]piperidin-4-amine |
| SMILES | Cc1nsc(N2CCC(Nc3ccn(Cc4cc(F)c(F)c(F)c4)n3)CC2)n1 |
| InChI | InChI=1S/C18H19F3N6S/c1-11-22-18(28-25-11)26-5-2-13(3-6-26)23-16-4-7-27(24-16)10-12-8-14(19)17(21)15(20)9-12/h4,7-9,13H,2-3,5-6,10H2,1H3,(H,23,24) |
| InChIKey | SHXMLOWRFIRPGK-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|