C27H40O — CID 53353535
4-methyl-2,6-bis(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)phenol (PubChem CID 53353535) has the molecular formula C27H40O and a molecular weight of 380.62 g/mol. Its IUPAC name is 4-methyl-2,6-bis(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)phenol.
| Compound Name | 4-methyl-2,6-bis(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)phenol |
|---|---|
| PubChem CID | 53353535 |
| Molecular Formula | C27H40O |
| Molecular Weight | 380.62 g/mol |
| Exact Mass | 380.31 |
| IUPAC Name | 4-methyl-2,6-bis(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)phenol |
| SMILES | Cc1cc(C2CC3CCC2(C)C3(C)C)c(O)c(C2CC3CCC2(C)C3(C)C)c1 |
| InChI | InChI=1S/C27H40O/c1-16-12-19(21-14-17-8-10-26(21,6)24(17,2)3)23(28)20(13-16)22-15-18-9-11-27(22,7)25(18,4)5/h12-13,17-18,21-22,28H,8-11,14-15H2,1-7H3 |
| InChIKey | RQOGXGGBUXACEE-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.62 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |