C20H19F2N7S — CID 53353628
8-(3,4-difluorophenyl)-N-[1-(3-methyl-1,2,4-thiadiazol-5-yl)piperidin-4-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 53353628) has the molecular formula C20H19F2N7S and a molecular weight of 427.48 g/mol. Its IUPAC name is 8-(3,4-difluorophenyl)-N-[1-(3-methyl-1,2,4-thiadiazol-5-yl)piperidin-4-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | 8-(3,4-difluorophenyl)-N-[1-(3-methyl-1,2,4-thiadiazol-5-yl)piperidin-4-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 53353628 |
| Molecular Formula | C20H19F2N7S |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 8-(3,4-difluorophenyl)-N-[1-(3-methyl-1,2,4-thiadiazol-5-yl)piperidin-4-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | Cc1nsc(N2CCC(Nc3nc4c(-c5ccc(F)c(F)c5)cccn4n3)CC2)n1 |
| InChI | InChI=1S/C20H19F2N7S/c1-12-23-20(30-27-12)28-9-6-14(7-10-28)24-19-25-18-15(3-2-8-29(18)26-19)13-4-5-16(21)17(22)11-13/h2-5,8,11,14H,6-7,9-10H2,1H3,(H,24,26) |
| InChIKey | IGYPLORWXVEQGK-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 71.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |