C14H20Cl2N2O — CID 53353682
4,5-dichloro-2-(3,3,5,5-tetramethylcyclohexyl)pyridazin-3-one (PubChem CID 53353682) has the molecular formula C14H20Cl2N2O and a molecular weight of 303.23 g/mol. Its IUPAC name is 4,5-dichloro-2-(3,3,5,5-tetramethylcyclohexyl)pyridazin-3-one.
| Compound Name | 4,5-dichloro-2-(3,3,5,5-tetramethylcyclohexyl)pyridazin-3-one |
|---|---|
| PubChem CID | 53353682 |
| Molecular Formula | C14H20Cl2N2O |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 4,5-dichloro-2-(3,3,5,5-tetramethylcyclohexyl)pyridazin-3-one |
| SMILES | CC1(C)CC(n2ncc(Cl)c(Cl)c2=O)CC(C)(C)C1 |
| InChI | InChI=1S/C14H20Cl2N2O/c1-13(2)5-9(6-14(3,4)8-13)18-12(19)11(16)10(15)7-17-18/h7,9H,5-6,8H2,1-4H3 |
| InChIKey | DFIVWRVLJYNACC-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |