C22H39NO6 — CID 53354099
1-(tert-butylamino)-3-[[(1S,4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]propan-2-ol (PubChem CID 53354099) has the molecular formula C22H39NO6 and a molecular weight of 413.56 g/mol. Its IUPAC name is 1-(tert-butylamino)-3-[[(1S,4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]propan-2-ol.
| Compound Name | 1-(tert-butylamino)-3-[[(1S,4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]propan-2-ol |
|---|---|
| PubChem CID | 53354099 |
| Molecular Formula | C22H39NO6 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.28 |
| IUPAC Name | 1-(tert-butylamino)-3-[[(1S,4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]propan-2-ol |
| SMILES | C[C@H]1[C@H](OCC(O)CNC(C)(C)C)O[C@@H]2O[C@]3(C)CC[C@H]4[C@H](C)CC[C@@H]1[C@@]24OO3 |
| InChI | InChI=1S/C22H39NO6/c1-13-7-8-17-14(2)18(25-12-15(24)11-23-20(3,4)5)26-19-22(17)16(13)9-10-21(6,27-19)28-29-22/h13-19,23-24H,7-12H2,1-6H3/t13-,14-,15?,16+,17+,18-,19-,21+,22-/m1/s1 |
| InChIKey | QMFCNBVITHKNRJ-NHCBRVKASA-N |
| XLogP | 2.96 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|