C21H19F4N7S — CID 53354112
8-[2-fluoro-4-(trifluoromethyl)phenyl]-N-[1-(3-methyl-1,2,4-thiadiazol-5-yl)piperidin-4-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 53354112) has the molecular formula C21H19F4N7S and a molecular weight of 477.49 g/mol. Its IUPAC name is 8-[2-fluoro-4-(trifluoromethyl)phenyl]-N-[1-(3-methyl-1,2,4-thiadiazol-5-yl)piperidin-4-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | 8-[2-fluoro-4-(trifluoromethyl)phenyl]-N-[1-(3-methyl-1,2,4-thiadiazol-5-yl)piperidin-4-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 53354112 |
| Molecular Formula | C21H19F4N7S |
| Molecular Weight | 477.49 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | 8-[2-fluoro-4-(trifluoromethyl)phenyl]-N-[1-(3-methyl-1,2,4-thiadiazol-5-yl)piperidin-4-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | Cc1nsc(N2CCC(Nc3nc4c(-c5ccc(C(F)(F)F)cc5F)cccn4n3)CC2)n1 |
| InChI | InChI=1S/C21H19F4N7S/c1-12-26-20(33-30-12)31-9-6-14(7-10-31)27-19-28-18-16(3-2-8-32(18)29-19)15-5-4-13(11-17(15)22)21(23,24)25/h2-5,8,11,14H,6-7,9-10H2,1H3,(H,27,29) |
| InChIKey | XPUXJCCHNUSVGY-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 71.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.49 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |