C20H18F3N7S — CID 53354116
N-[1-(3-methyl-1,2,4-thiadiazol-5-yl)piperidin-4-yl]-8-(2,3,4-trifluorophenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 53354116) has the molecular formula C20H18F3N7S and a molecular weight of 445.47 g/mol. Its IUPAC name is N-[1-(3-methyl-1,2,4-thiadiazol-5-yl)piperidin-4-yl]-8-(2,3,4-trifluorophenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | N-[1-(3-methyl-1,2,4-thiadiazol-5-yl)piperidin-4-yl]-8-(2,3,4-trifluorophenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 53354116 |
| Molecular Formula | C20H18F3N7S |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | N-[1-(3-methyl-1,2,4-thiadiazol-5-yl)piperidin-4-yl]-8-(2,3,4-trifluorophenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | Cc1nsc(N2CCC(Nc3nc4c(-c5ccc(F)c(F)c5F)cccn4n3)CC2)n1 |
| InChI | InChI=1S/C20H18F3N7S/c1-11-24-20(31-28-11)29-9-6-12(7-10-29)25-19-26-18-14(3-2-8-30(18)27-19)13-4-5-15(21)17(23)16(13)22/h2-5,8,12H,6-7,9-10H2,1H3,(H,25,27) |
| InChIKey | HFUJMPWOEYCOFW-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 71.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|