C20H22F3N7S — CID 53354117
8-(3,4-difluorophenyl)-6-fluoro-N-[1-(3-methyl-1,2,4-thiadiazol-5-yl)piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 53354117) has the molecular formula C20H22F3N7S and a molecular weight of 449.51 g/mol. Its IUPAC name is 8-(3,4-difluorophenyl)-6-fluoro-N-[1-(3-methyl-1,2,4-thiadiazol-5-yl)piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | 8-(3,4-difluorophenyl)-6-fluoro-N-[1-(3-methyl-1,2,4-thiadiazol-5-yl)piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 53354117 |
| Molecular Formula | C20H22F3N7S |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | 8-(3,4-difluorophenyl)-6-fluoro-N-[1-(3-methyl-1,2,4-thiadiazol-5-yl)piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | Cc1nsc(N2CCC(Nc3nc4n(n3)CC(F)CC4c3ccc(F)c(F)c3)CC2)n1 |
| InChI | InChI=1S/C20H22F3N7S/c1-11-24-20(31-28-11)29-6-4-14(5-7-29)25-19-26-18-15(9-13(21)10-30(18)27-19)12-2-3-16(22)17(23)8-12/h2-3,8,13-15H,4-7,9-10H2,1H3,(H,25,27) |
| InChIKey | WXOWBBIWFHQCTL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |