C20H18ClF2N7S — CID 53354216
8-(3-chloro-4-fluorophenyl)-6-fluoro-N-[1-(3-methyl-1,2,4-thiadiazol-5-yl)piperidin-4-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 53354216) has the molecular formula C20H18ClF2N7S and a molecular weight of 461.93 g/mol. Its IUPAC name is 8-(3-chloro-4-fluorophenyl)-6-fluoro-N-[1-(3-methyl-1,2,4-thiadiazol-5-yl)piperidin-4-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | 8-(3-chloro-4-fluorophenyl)-6-fluoro-N-[1-(3-methyl-1,2,4-thiadiazol-5-yl)piperidin-4-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 53354216 |
| Molecular Formula | C20H18ClF2N7S |
| Molecular Weight | 461.93 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | 8-(3-chloro-4-fluorophenyl)-6-fluoro-N-[1-(3-methyl-1,2,4-thiadiazol-5-yl)piperidin-4-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | Cc1nsc(N2CCC(Nc3nc4c(-c5ccc(F)c(Cl)c5)cc(F)cn4n3)CC2)n1 |
| InChI | InChI=1S/C20H18ClF2N7S/c1-11-24-20(31-28-11)29-6-4-14(5-7-29)25-19-26-18-15(9-13(22)10-30(18)27-19)12-2-3-17(23)16(21)8-12/h2-3,8-10,14H,4-7H2,1H3,(H,25,27) |
| InChIKey | SFXTWOALCMDKCJ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 71.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.93 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |