C19H19FN8S — CID 53354320
8-(2-fluoro-3-pyridinyl)-N-[1-(3-methyl-1,2,4-thiadiazol-5-yl)piperidin-4-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 53354320) has the molecular formula C19H19FN8S and a molecular weight of 410.48 g/mol. Its IUPAC name is 8-(2-fluoro-3-pyridinyl)-N-[1-(3-methyl-1,2,4-thiadiazol-5-yl)piperidin-4-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | 8-(2-fluoro-3-pyridinyl)-N-[1-(3-methyl-1,2,4-thiadiazol-5-yl)piperidin-4-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 53354320 |
| Molecular Formula | C19H19FN8S |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 8-(2-fluoro-3-pyridinyl)-N-[1-(3-methyl-1,2,4-thiadiazol-5-yl)piperidin-4-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | Cc1nsc(N2CCC(Nc3nc4c(-c5cccnc5F)cccn4n3)CC2)n1 |
| InChI | InChI=1S/C19H19FN8S/c1-12-22-19(29-26-12)27-10-6-13(7-11-27)23-18-24-17-15(5-3-9-28(17)25-18)14-4-2-8-21-16(14)20/h2-5,8-9,13H,6-7,10-11H2,1H3,(H,23,25) |
| InChIKey | HCDXOZGSRNFJBP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 84.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|