C19H20N2O8S2 — CID 53354440
5-[[4-[2-(5-ethyl-2-pyridinyl)-2-oxoethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione;sulfuric acid (PubChem CID 53354440) has the molecular formula C19H20N2O8S2 and a molecular weight of 468.51 g/mol. Its IUPAC name is 5-[[4-[2-(5-ethyl-2-pyridinyl)-2-oxoethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione;sulfuric acid.
| Compound Name | 5-[[4-[2-(5-ethyl-2-pyridinyl)-2-oxoethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione;sulfuric acid |
|---|---|
| PubChem CID | 53354440 |
| Molecular Formula | C19H20N2O8S2 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.07 |
| IUPAC Name | 5-[[4-[2-(5-ethyl-2-pyridinyl)-2-oxoethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione;sulfuric acid |
| SMILES | CCc1ccc(C(=O)COc2ccc(CC3SC(=O)NC3=O)cc2)nc1.O=S(=O)(O)O |
| InChI | InChI=1S/C19H18N2O4S.H2O4S/c1-2-12-5-8-15(20-10-12)16(22)11-25-14-6-3-13(4-7-14)9-17-18(23)21-19(24)26-17;1-5(2,3)4/h3-8,10,17H,2,9,11H2,1H3,(H,21,23,24);(H2,1,2,3,4) |
| InChIKey | ZAQBQXQEWVKYJO-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 159.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|