C28H21ClF4N6 — CID 53354526
N-[1-(2-chloro-4-pyridinyl)piperidin-4-yl]-6,8-bis(3,4-difluorophenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 53354526) has the molecular formula C28H21ClF4N6 and a molecular weight of 552.96 g/mol. Its IUPAC name is N-[1-(2-chloro-4-pyridinyl)piperidin-4-yl]-6,8-bis(3,4-difluorophenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | N-[1-(2-chloro-4-pyridinyl)piperidin-4-yl]-6,8-bis(3,4-difluorophenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 53354526 |
| Molecular Formula | C28H21ClF4N6 |
| Molecular Weight | 552.96 g/mol |
| Exact Mass | 552.15 |
| IUPAC Name | N-[1-(2-chloro-4-pyridinyl)piperidin-4-yl]-6,8-bis(3,4-difluorophenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | Fc1ccc(-c2cc(-c3ccc(F)c(F)c3)c3nc(NC4CCN(c5ccnc(Cl)c5)CC4)nn3c2)cc1F |
| InChI | InChI=1S/C28H21ClF4N6/c29-26-14-20(5-8-34-26)38-9-6-19(7-10-38)35-28-36-27-21(17-2-4-23(31)25(33)13-17)11-18(15-39(27)37-28)16-1-3-22(30)24(32)12-16/h1-5,8,11-15,19H,6-7,9-10H2,(H,35,37) |
| InChIKey | RPEQQHZZVRFWMS-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 58.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.96 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|