C20H24FN7S — CID 53354527
8-(4-fluorophenyl)-N-[1-(3-methyl-1,2,4-thiadiazol-5-yl)piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 53354527) has the molecular formula C20H24FN7S and a molecular weight of 413.53 g/mol. Its IUPAC name is 8-(4-fluorophenyl)-N-[1-(3-methyl-1,2,4-thiadiazol-5-yl)piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | 8-(4-fluorophenyl)-N-[1-(3-methyl-1,2,4-thiadiazol-5-yl)piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 53354527 |
| Molecular Formula | C20H24FN7S |
| Molecular Weight | 413.53 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | 8-(4-fluorophenyl)-N-[1-(3-methyl-1,2,4-thiadiazol-5-yl)piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | Cc1nsc(N2CCC(Nc3nc4n(n3)CCCC4c3ccc(F)cc3)CC2)n1 |
| InChI | InChI=1S/C20H24FN7S/c1-13-22-20(29-26-13)27-11-8-16(9-12-27)23-19-24-18-17(3-2-10-28(18)25-19)14-4-6-15(21)7-5-14/h4-7,16-17H,2-3,8-12H2,1H3,(H,23,25) |
| InChIKey | MBNLEPLTMGVBLT-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.53 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |