C6H13NO4 — CID 53354586
(2R,3R,4R)-2,4-bis(hydroxymethyl)pyrrolidine-3,4-diol (PubChem CID 53354586) has the molecular formula C6H13NO4 and a molecular weight of 163.17 g/mol. Its IUPAC name is (2R,3R,4R)-2,4-bis(hydroxymethyl)pyrrolidine-3,4-diol.
| Compound Name | (2R,3R,4R)-2,4-bis(hydroxymethyl)pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 53354586 |
| Molecular Formula | C6H13NO4 |
| Molecular Weight | 163.17 g/mol |
| Exact Mass | 163.08 |
| IUPAC Name | (2R,3R,4R)-2,4-bis(hydroxymethyl)pyrrolidine-3,4-diol |
| SMILES | OC[C@H]1NC[C@@](O)(CO)[C@@H]1O |
| InChI | InChI=1S/C6H13NO4/c8-1-4-5(10)6(11,3-9)2-7-4/h4-5,7-11H,1-3H2/t4-,5-,6-/m1/s1 |
| InChIKey | ZQMIUAFBMMIDFA-HSUXUTPPSA-N |
| XLogP | -2.97 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.17 |
| LogP ≤ 5 | -2.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |