C15H10Cl2N4 — CID 53354632
6-(3,5-Dichlorophenyl)-5-phenyl-1,2,4-triazin-3-amine (PubChem CID 53354632) has the molecular formula C15H10Cl2N4 and a molecular weight of 317.20 g/mol. Its IUPAC name is 6-(3,5-dichlorophenyl)-5-phenyl-1,2,4-triazin-3-amine.
| Compound Name | 6-(3,5-Dichlorophenyl)-5-phenyl-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 53354632 |
| Molecular Formula | C15H10Cl2N4 |
| Molecular Weight | 317.20 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | 6-(3,5-dichlorophenyl)-5-phenyl-1,2,4-triazin-3-amine |
| SMILES | C1=CC=C(C=C1)C2=C(N=NC(=N2)N)C3=CC(=CC(=C3)Cl)Cl |
| InChI | InChI=1S/C15H10Cl2N4/c16-11-6-10(7-12(17)8-11)14-13(19-15(18)21-20-14)9-4-2-1-3-5-9/h1-8H,(H2,18,19,21) |
| InChIKey | HMAOALRIGFSFDY-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 64.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | 328 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.20 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |