C20H20FN7S — CID 53354633
8-(4-fluorophenyl)-N-[1-(3-methyl-1,2,4-thiadiazol-5-yl)piperidin-4-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 53354633) has the molecular formula C20H20FN7S and a molecular weight of 409.49 g/mol. Its IUPAC name is 8-(4-fluorophenyl)-N-[1-(3-methyl-1,2,4-thiadiazol-5-yl)piperidin-4-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | 8-(4-fluorophenyl)-N-[1-(3-methyl-1,2,4-thiadiazol-5-yl)piperidin-4-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 53354633 |
| Molecular Formula | C20H20FN7S |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 8-(4-fluorophenyl)-N-[1-(3-methyl-1,2,4-thiadiazol-5-yl)piperidin-4-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | Cc1nsc(N2CCC(Nc3nc4c(-c5ccc(F)cc5)cccn4n3)CC2)n1 |
| InChI | InChI=1S/C20H20FN7S/c1-13-22-20(29-26-13)27-11-8-16(9-12-27)23-19-24-18-17(3-2-10-28(18)25-19)14-4-6-15(21)7-5-14/h2-7,10,16H,8-9,11-12H2,1H3,(H,23,25) |
| InChIKey | JNZPITFFPGJOFB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 71.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |