C16H21N5 — CID 53354728
6-(3,3-dimethylpiperidin-1-yl)-5-phenyl-1,2,4-triazin-3-amine (PubChem CID 53354728) has the molecular formula C16H21N5 and a molecular weight of 283.38 g/mol. Its IUPAC name is 6-(3,3-dimethylpiperidin-1-yl)-5-phenyl-1,2,4-triazin-3-amine.
| Compound Name | 6-(3,3-dimethylpiperidin-1-yl)-5-phenyl-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 53354728 |
| Molecular Formula | C16H21N5 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 6-(3,3-dimethylpiperidin-1-yl)-5-phenyl-1,2,4-triazin-3-amine |
| SMILES | CC1(C)CCCN(c2nnc(N)nc2-c2ccccc2)C1 |
| InChI | InChI=1S/C16H21N5/c1-16(2)9-6-10-21(11-16)14-13(18-15(17)20-19-14)12-7-4-3-5-8-12/h3-5,7-8H,6,9-11H2,1-2H3,(H2,17,18,20) |
| InChIKey | QRDFCTALHLWPRP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |