C17H18F3N7S — CID 53354733
1-(3-methyl-1,2,4-thiadiazol-5-yl)-N-[1-[(3,4,5-trifluorophenyl)methyl]-1,2,4-triazol-3-yl]piperidin-4-amine (PubChem CID 53354733) has the molecular formula C17H18F3N7S and a molecular weight of 409.44 g/mol. Its IUPAC name is 1-(3-methyl-1,2,4-thiadiazol-5-yl)-N-[1-[(3,4,5-trifluorophenyl)methyl]-1,2,4-triazol-3-yl]piperidin-4-amine.
| Compound Name | 1-(3-methyl-1,2,4-thiadiazol-5-yl)-N-[1-[(3,4,5-trifluorophenyl)methyl]-1,2,4-triazol-3-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 53354733 |
| Molecular Formula | C17H18F3N7S |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 1-(3-methyl-1,2,4-thiadiazol-5-yl)-N-[1-[(3,4,5-trifluorophenyl)methyl]-1,2,4-triazol-3-yl]piperidin-4-amine |
| SMILES | Cc1nsc(N2CCC(Nc3ncn(Cc4cc(F)c(F)c(F)c4)n3)CC2)n1 |
| InChI | InChI=1S/C17H18F3N7S/c1-10-22-17(28-25-10)26-4-2-12(3-5-26)23-16-21-9-27(24-16)8-11-6-13(18)15(20)14(19)7-11/h6-7,9,12H,2-5,8H2,1H3,(H,23,24) |
| InChIKey | HPYGFRQRVBVVJV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|