C22H32O6 — CID 53355888
(2E,6E)-8-[(2E,6E)-8-acetyloxy-2,6-dimethylocta-2,6-dienoyl]oxy-2,6-dimethylocta-2,6-dienoic acid (PubChem CID 53355888) has the molecular formula C22H32O6 and a molecular weight of 392.49 g/mol. Its IUPAC name is (2E,6E)-8-[(2E,6E)-8-acetyloxy-2,6-dimethylocta-2,6-dienoyl]oxy-2,6-dimethylocta-2,6-dienoic acid.
| Compound Name | (2E,6E)-8-[(2E,6E)-8-acetyloxy-2,6-dimethylocta-2,6-dienoyl]oxy-2,6-dimethylocta-2,6-dienoic acid |
|---|---|
| PubChem CID | 53355888 |
| Molecular Formula | C22H32O6 |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | (2E,6E)-8-[(2E,6E)-8-acetyloxy-2,6-dimethylocta-2,6-dienoyl]oxy-2,6-dimethylocta-2,6-dienoic acid |
| SMILES | CC(=O)OC/C=C(\C)CC/C=C(\C)C(=O)OC/C=C(\C)CC/C=C(\C)C(=O)O |
| InChI | InChI=1S/C22H32O6/c1-16(12-14-27-20(5)23)9-7-11-19(4)22(26)28-15-13-17(2)8-6-10-18(3)21(24)25/h10-13H,6-9,14-15H2,1-5H3,(H,24,25)/b16-12+,17-13+,18-10+,19-11+ |
| InChIKey | AGAVMZLTUOZPDI-MSCZLACJSA-N |
| XLogP | 4.52 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|