C37H44O18 — CID 53355890
Vandateroside Ii (PubChem CID 53355890) has the molecular formula C37H44O18 and a molecular weight of 776.70 g/mol. Its IUPAC name is bis[[4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl] (2R)-2-hydroxy-2-[(4-hydroxyphenyl)methyl]butanedioate.
| Compound Name | Vandateroside Ii |
|---|---|
| PubChem CID | 53355890 |
| Molecular Formula | C37H44O18 |
| Molecular Weight | 776.70 g/mol |
| Exact Mass | 776.25 |
| IUPAC Name | bis[[4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl] (2R)-2-hydroxy-2-[(4-hydroxyphenyl)methyl]butanedioate |
| SMILES | C1=CC(=CC=C1C[C@@](CC(=O)OCC2=CC=C(C=C2)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)(C(=O)OCC4=CC=C(C=C4)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)O)O |
| InChI | InChI=1S/C37H44O18/c38-15-25-28(42)30(44)32(46)34(54-25)52-23-9-3-20(4-10-23)17-50-27(41)14-37(49,13-19-1-7-22(40)8-2-19)36(48)51-18-21-5-11-24(12-6-21)53-35-33(47)31(45)29(43)26(16-39)55-35/h1-12,25-26,28-35,38-40,42-47,49H,13-18H2/t25-,26-,28-,29-,30+,31+,32-,33-,34-,35-,37-/m1/s1 |
| InChIKey | DGKISHSPYWCSLM-VODBULHWSA-N |
| XLogP | -0.60 |
| TPSA | 292.00 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | 1190 |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.70 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 18 |