C25H38O5 — CID 53355993
(2R)-2-[(2Z,6E,10E,14E)-16-hydroxy-3-(hydroxymethyl)-7,11,15-trimethylhexadeca-2,6,10,14-tetraenyl]-3-(hydroxymethyl)-2H-furan-5-one (PubChem CID 53355993) has the molecular formula C25H38O5 and a molecular weight of 418.57 g/mol. Its IUPAC name is (2R)-2-[(2Z,6E,10E,14E)-16-hydroxy-3-(hydroxymethyl)-7,11,15-trimethylhexadeca-2,6,10,14-tetraenyl]-3-(hydroxymethyl)-2H-furan-5-one.
| Compound Name | (2R)-2-[(2Z,6E,10E,14E)-16-hydroxy-3-(hydroxymethyl)-7,11,15-trimethylhexadeca-2,6,10,14-tetraenyl]-3-(hydroxymethyl)-2H-furan-5-one |
|---|---|
| PubChem CID | 53355993 |
| Molecular Formula | C25H38O5 |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | (2R)-2-[(2Z,6E,10E,14E)-16-hydroxy-3-(hydroxymethyl)-7,11,15-trimethylhexadeca-2,6,10,14-tetraenyl]-3-(hydroxymethyl)-2H-furan-5-one |
| SMILES | C/C(=C\CC/C(C)=C/CC/C(C)=C/CC/C(=C/C[C@H]1OC(=O)C=C1CO)CO)CO |
| InChI | InChI=1S/C25H38O5/c1-19(9-5-11-21(3)16-26)7-4-8-20(2)10-6-12-22(17-27)13-14-24-23(18-28)15-25(29)30-24/h7,10-11,13,15,24,26-28H,4-6,8-9,12,14,16-18H2,1-3H3/b19-7+,20-10+,21-11+,22-13-/t24-/m1/s1 |
| InChIKey | QYNVMFGBDSWBRM-YLASZLQJSA-N |
| XLogP | 4.31 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|