C17H11F6NO3 — CID 53356057
methyl 3-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl]benzoate (PubChem CID 53356057) has the molecular formula C17H11F6NO3 and a molecular weight of 391.27 g/mol. Its IUPAC name is methyl 3-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl]benzoate.
| Compound Name | methyl 3-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 53356057 |
| Molecular Formula | C17H11F6NO3 |
| Molecular Weight | 391.27 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | methyl 3-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl]benzoate |
| SMILES | COC(=O)c1cccc(C(=O)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C17H11F6NO3/c1-27-15(26)10-4-2-3-9(5-10)14(25)24-13-7-11(16(18,19)20)6-12(8-13)17(21,22)23/h2-8H,1H3,(H,24,25) |
| InChIKey | FEFVZBRQJRSSGR-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.27 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |