About tert-butyl (2S)-2-[(1R,2R)-3-fluoro-1-methoxy-2-methyl-3-oxopropyl]pyrrolidine-1-carboxylate
tert-butyl (2S)-2-[(1R,2R)-3-fluoro-1-methoxy-2-methyl-3-oxopropyl]pyrrolidine-1-carboxylate (PubChem CID 53356198) has the molecular formula C14H24FNO4
and a molecular weight of 289.35 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(1R,2R)-3-fluoro-1-methoxy-2-methyl-3-oxopropyl]pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (2S)-2-[(1R,2R)-3-fluoro-1-methoxy-2-methyl-3-oxopropyl]pyrrolidine-1-carboxylate |
| PubChem CID | 53356198 |
| Molecular Formula | C14H24FNO4 |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | tert-butyl (2S)-2-[(1R,2R)-3-fluoro-1-methoxy-2-methyl-3-oxopropyl]pyrrolidine-1-carboxylate |
| SMILES | CO[C@H]([C@@H](C)C(=O)F)[C@@H]1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H24FNO4/c1-9(12(15)17)11(19-5)10-7-6-8-16(10)13(18)20-14(2,3)4/h9-11H,6-8H2,1-5H3/t9-,10+,11-/m1/s1 |
| InChIKey | DRRJVSLFSXLEJU-OUAUKWLOSA-N |
| XLogP | 2.53 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (2S)-2-[(1R,2R)-3-fluoro-1-methoxy-2-methyl-3-oxopropyl]pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2S)-2-[(1R,2R)-3-fluoro-1-methoxy-2-methyl-3-oxopropyl]pyrrolidine-1-carboxylate?
The IUPAC name of tert-butyl (2S)-2-[(1R,2R)-3-fluoro-1-methoxy-2-methyl-3-oxopropyl]pyrrolidine-1-carboxylate (CID 53356198) is tert-butyl (2S)-2-[(1R,2R)-3-fluoro-1-methoxy-2-methyl-3-oxopropyl]pyrrolidine-1-carboxylate.
What is the SMILES notation for tert-butyl (2S)-2-[(1R,2R)-3-fluoro-1-methoxy-2-methyl-3-oxopropyl]pyrrolidine-1-carboxylate?
The canonical SMILES for tert-butyl (2S)-2-[(1R,2R)-3-fluoro-1-methoxy-2-methyl-3-oxopropyl]pyrrolidine-1-carboxylate is CO[C@H]([C@@H](C)C(=O)F)[C@@H]1CCCN1C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl (2S)-2-[(1R,2R)-3-fluoro-1-methoxy-2-methyl-3-oxopropyl]pyrrolidine-1-carboxylate?
The InChIKey is DRRJVSLFSXLEJU-OUAUKWLOSA-N. The full InChI is InChI=1S/C14H24FNO4/c1-9(12(15)17)11(19-5)10-7-6-8-16(10)13(18)20-14(2,3)4/h9-11H,6-8H2,1-5H3/t9-,10+,11-/m1/s1.
What are the key properties of tert-butyl (2S)-2-[(1R,2R)-3-fluoro-1-methoxy-2-methyl-3-oxopropyl]pyrrolidine-1-carboxylate?
tert-butyl (2S)-2-[(1R,2R)-3-fluoro-1-methoxy-2-methyl-3-oxopropyl]pyrrolidine-1-carboxylate has a molecular weight of 289.35 g/mol, XLogP of 2.53, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2S)-2-[(1R,2R)-3-fluoro-1-methoxy-2-methyl-3-oxopropyl]pyrrolidine-1-carboxylate is sourced from PubChem (CID 53356198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).