C21H20F3N5O3S — CID 53356332
N-(4-hydroxybutyl)-1-methyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazole-5-carboxamide (PubChem CID 53356332) has the molecular formula C21H20F3N5O3S and a molecular weight of 479.48 g/mol. Its IUPAC name is N-(4-hydroxybutyl)-1-methyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazole-5-carboxamide.
| Compound Name | N-(4-hydroxybutyl)-1-methyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 53356332 |
| Molecular Formula | C21H20F3N5O3S |
| Molecular Weight | 479.48 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | N-(4-hydroxybutyl)-1-methyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazole-5-carboxamide |
| SMILES | Cn1c(Nc2nc3ccc(OC(F)(F)F)cc3s2)nc2cc(C(=O)NCCCCO)ccc21 |
| InChI | InChI=1S/C21H20F3N5O3S/c1-29-16-7-4-12(18(31)25-8-2-3-9-30)10-15(16)26-19(29)28-20-27-14-6-5-13(11-17(14)33-20)32-21(22,23)24/h4-7,10-11,30H,2-3,8-9H2,1H3,(H,25,31)(H,26,27,28) |
| InChIKey | MJZWZCCSAPBQQK-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.48 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|