C20H21NO2 — CID 53356391
(3'R,4R,5R)-3',4,5-trimethyl-3'-phenylspiro[1,3-dioxolane-2,4'-quinoline] (PubChem CID 53356391) has the molecular formula C20H21NO2 and a molecular weight of 307.39 g/mol. Its IUPAC name is (3'R,4R,5R)-3',4,5-trimethyl-3'-phenylspiro[1,3-dioxolane-2,4'-quinoline].
| Compound Name | (3'R,4R,5R)-3',4,5-trimethyl-3'-phenylspiro[1,3-dioxolane-2,4'-quinoline] |
|---|---|
| PubChem CID | 53356391 |
| Molecular Formula | C20H21NO2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | (3'R,4R,5R)-3',4,5-trimethyl-3'-phenylspiro[1,3-dioxolane-2,4'-quinoline] |
| SMILES | C[C@H]1OC2(O[C@@H]1C)c1ccccc1N=C[C@@]2(C)c1ccccc1 |
| InChI | InChI=1S/C20H21NO2/c1-14-15(2)23-20(22-14)17-11-7-8-12-18(17)21-13-19(20,3)16-9-5-4-6-10-16/h4-15H,1-3H3/t14-,15-,19+/m1/s1 |
| InChIKey | OZWGORBOHMFFHG-CLCXKQKWSA-N |
| XLogP | 4.34 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |