C18H11F2N5O3 — CID 53356455
9-(2,4-difluorophenyl)-2-(3-hydroxyphenyl)-8-oxo-7H-purine-6-carboxamide (PubChem CID 53356455) has the molecular formula C18H11F2N5O3 and a molecular weight of 383.31 g/mol. Its IUPAC name is 9-(2,4-difluorophenyl)-2-(3-hydroxyphenyl)-8-oxo-7H-purine-6-carboxamide.
| Compound Name | 9-(2,4-difluorophenyl)-2-(3-hydroxyphenyl)-8-oxo-7H-purine-6-carboxamide |
|---|---|
| PubChem CID | 53356455 |
| Molecular Formula | C18H11F2N5O3 |
| Molecular Weight | 383.31 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | 9-(2,4-difluorophenyl)-2-(3-hydroxyphenyl)-8-oxo-7H-purine-6-carboxamide |
| SMILES | NC(=O)c1nc(-c2cccc(O)c2)nc2c1[nH]c(=O)n2-c1ccc(F)cc1F |
| InChI | InChI=1S/C18H11F2N5O3/c19-9-4-5-12(11(20)7-9)25-17-14(23-18(25)28)13(15(21)27)22-16(24-17)8-2-1-3-10(26)6-8/h1-7,26H,(H2,21,27)(H,23,28) |
| InChIKey | XJQGKRILIIUBIY-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 126.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |