C31H30Cl2F2N4O3 — CID 53357225
methyl 5-[[[(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]methyl]pyridine-2-carboxylate (PubChem CID 53357225) has the molecular formula C31H30Cl2F2N4O3 and a molecular weight of 615.51 g/mol. Its IUPAC name is methyl 5-[[[(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]methyl]pyridine-2-carboxylate.
| Compound Name | methyl 5-[[[(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]methyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 53357225 |
| Molecular Formula | C31H30Cl2F2N4O3 |
| Molecular Weight | 615.51 g/mol |
| Exact Mass | 614.17 |
| IUPAC Name | methyl 5-[[[(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]methyl]pyridine-2-carboxylate |
| SMILES | COC(=O)c1ccc(CNC(=O)[C@@H]2N[C@@H](CC(C)(C)C)[C@](C#N)(c3ccc(Cl)cc3F)[C@H]2c2cccc(Cl)c2F)cn1 |
| InChI | InChI=1S/C31H30Cl2F2N4O3/c1-30(2,3)13-24-31(16-36,20-10-9-18(32)12-22(20)34)25(19-6-5-7-21(33)26(19)35)27(39-24)28(40)38-15-17-8-11-23(37-14-17)29(41)42-4/h5-12,14,24-25,27,39H,13,15H2,1-4H3,(H,38,40)/t24-,25-,27+,31-/m0/s1 |
| InChIKey | OOPKMKFAIHKGAJ-LJQIRTBHSA-N |
| XLogP | 6.09 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.51 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |