C32H32Cl2F2N4O3 — CID 53357227
ethyl 6-[[[(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]methyl]pyridine-3-carboxylate (PubChem CID 53357227) has the molecular formula C32H32Cl2F2N4O3 and a molecular weight of 629.54 g/mol. Its IUPAC name is ethyl 6-[[[(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]methyl]pyridine-3-carboxylate.
| Compound Name | ethyl 6-[[[(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]methyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 53357227 |
| Molecular Formula | C32H32Cl2F2N4O3 |
| Molecular Weight | 629.54 g/mol |
| Exact Mass | 628.18 |
| IUPAC Name | ethyl 6-[[[(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]methyl]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(CNC(=O)[C@@H]2N[C@@H](CC(C)(C)C)[C@](C#N)(c3ccc(Cl)cc3F)[C@H]2c2cccc(Cl)c2F)nc1 |
| InChI | InChI=1S/C32H32Cl2F2N4O3/c1-5-43-30(42)18-9-11-20(38-15-18)16-39-29(41)28-26(21-7-6-8-23(34)27(21)36)32(17-37,25(40-28)14-31(2,3)4)22-12-10-19(33)13-24(22)35/h6-13,15,25-26,28,40H,5,14,16H2,1-4H3,(H,39,41)/t25-,26-,28+,32-/m0/s1 |
| InChIKey | KIJUIWGTZHWGCP-ULWUHOHFSA-N |
| XLogP | 6.48 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.54 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |