About (2-chloro-6H-thieno[2,3-b]pyrrol-5-yl)-(2-methyl-1-propylindol-3-yl)methanone
(2-chloro-6H-thieno[2,3-b]pyrrol-5-yl)-(2-methyl-1-propylindol-3-yl)methanone (PubChem CID 53357258) has the molecular formula C19H17ClN2OS
and a molecular weight of 356.88 g/mol. Its IUPAC name is (2-chloro-6H-thieno[2,3-b]pyrrol-5-yl)-(2-methyl-1-propylindol-3-yl)methanone.
Molecular Properties
| Compound Name | (2-chloro-6H-thieno[2,3-b]pyrrol-5-yl)-(2-methyl-1-propylindol-3-yl)methanone |
| PubChem CID | 53357258 |
| Molecular Formula | C19H17ClN2OS |
| Molecular Weight | 356.88 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | (2-chloro-6H-thieno[2,3-b]pyrrol-5-yl)-(2-methyl-1-propylindol-3-yl)methanone |
| SMILES | CCCn1c(C)c(C(=O)c2cc3cc(Cl)sc3[nH]2)c2ccccc21 |
| InChI | InChI=1S/C19H17ClN2OS/c1-3-8-22-11(2)17(13-6-4-5-7-15(13)22)18(23)14-9-12-10-16(20)24-19(12)21-14/h4-7,9-10,21H,3,8H2,1-2H3 |
| InChIKey | CUVOSUXRXGTEBS-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.88 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-chloro-6H-thieno[2,3-b]pyrrol-5-yl)-(2-methyl-1-propylindol-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chloro-6H-thieno[2,3-b]pyrrol-5-yl)-(2-methyl-1-propylindol-3-yl)methanone?
The IUPAC name of (2-chloro-6H-thieno[2,3-b]pyrrol-5-yl)-(2-methyl-1-propylindol-3-yl)methanone (CID 53357258) is (2-chloro-6H-thieno[2,3-b]pyrrol-5-yl)-(2-methyl-1-propylindol-3-yl)methanone.
What is the SMILES notation for (2-chloro-6H-thieno[2,3-b]pyrrol-5-yl)-(2-methyl-1-propylindol-3-yl)methanone?
The canonical SMILES for (2-chloro-6H-thieno[2,3-b]pyrrol-5-yl)-(2-methyl-1-propylindol-3-yl)methanone is CCCn1c(C)c(C(=O)c2cc3cc(Cl)sc3[nH]2)c2ccccc21.
What is the InChIKey of (2-chloro-6H-thieno[2,3-b]pyrrol-5-yl)-(2-methyl-1-propylindol-3-yl)methanone?
The InChIKey is CUVOSUXRXGTEBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17ClN2OS/c1-3-8-22-11(2)17(13-6-4-5-7-15(13)22)18(23)14-9-12-10-16(20)24-19(12)21-14/h4-7,9-10,21H,3,8H2,1-2H3.
What are the key properties of (2-chloro-6H-thieno[2,3-b]pyrrol-5-yl)-(2-methyl-1-propylindol-3-yl)methanone?
(2-chloro-6H-thieno[2,3-b]pyrrol-5-yl)-(2-methyl-1-propylindol-3-yl)methanone has a molecular weight of 356.88 g/mol, XLogP of 5.79, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chloro-6H-thieno[2,3-b]pyrrol-5-yl)-(2-methyl-1-propylindol-3-yl)methanone is sourced from PubChem (CID 53357258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).