C30H28Cl2F2N4O3 — CID 53357487
6-[[[(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]methyl]pyridine-3-carboxylic acid (PubChem CID 53357487) has the molecular formula C30H28Cl2F2N4O3 and a molecular weight of 601.48 g/mol. Its IUPAC name is 6-[[[(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]methyl]pyridine-3-carboxylic acid.
| Compound Name | 6-[[[(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]methyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 53357487 |
| Molecular Formula | C30H28Cl2F2N4O3 |
| Molecular Weight | 601.48 g/mol |
| Exact Mass | 600.15 |
| IUPAC Name | 6-[[[(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]methyl]pyridine-3-carboxylic acid |
| SMILES | CC(C)(C)C[C@@H]1N[C@@H](C(=O)NCc2ccc(C(=O)O)cn2)[C@H](c2cccc(Cl)c2F)[C@@]1(C#N)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C30H28Cl2F2N4O3/c1-29(2,3)12-23-30(15-35,20-10-8-17(31)11-22(20)33)24(19-5-4-6-21(32)25(19)34)26(38-23)27(39)37-14-18-9-7-16(13-36-18)28(40)41/h4-11,13,23-24,26,38H,12,14H2,1-3H3,(H,37,39)(H,40,41)/t23-,24-,26+,30-/m0/s1 |
| InChIKey | XOJFFCAKUUVRTK-FQFMIMTMSA-N |
| XLogP | 6.00 |
| TPSA | 115.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.48 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |