C20H27N7O — CID 53357956
3-[6-(2-methoxyethylamino)-3-pyridinyl]-N-(1-methylpiperidin-4-yl)imidazo[1,2-b]pyridazin-6-amine (PubChem CID 53357956) has the molecular formula C20H27N7O and a molecular weight of 381.48 g/mol. Its IUPAC name is 3-[6-(2-methoxyethylamino)-3-pyridinyl]-N-(1-methylpiperidin-4-yl)imidazo[1,2-b]pyridazin-6-amine.
| Compound Name | 3-[6-(2-methoxyethylamino)-3-pyridinyl]-N-(1-methylpiperidin-4-yl)imidazo[1,2-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 53357956 |
| Molecular Formula | C20H27N7O |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | 3-[6-(2-methoxyethylamino)-3-pyridinyl]-N-(1-methylpiperidin-4-yl)imidazo[1,2-b]pyridazin-6-amine |
| SMILES | COCCNc1ccc(-c2cnc3ccc(NC4CCN(C)CC4)nn23)cn1 |
| InChI | InChI=1S/C20H27N7O/c1-26-10-7-16(8-11-26)24-19-5-6-20-23-14-17(27(20)25-19)15-3-4-18(22-13-15)21-9-12-28-2/h3-6,13-14,16H,7-12H2,1-2H3,(H,21,22)(H,24,25) |
| InChIKey | CNSDVZGTOGCFPQ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|