C21H29N7 — CID 53358067
3-[6-(butylamino)-3-pyridinyl]-N-(1-methylpiperidin-4-yl)imidazo[1,2-b]pyridazin-6-amine (PubChem CID 53358067) has the molecular formula C21H29N7 and a molecular weight of 379.51 g/mol. Its IUPAC name is 3-[6-(butylamino)-3-pyridinyl]-N-(1-methylpiperidin-4-yl)imidazo[1,2-b]pyridazin-6-amine.
| Compound Name | 3-[6-(butylamino)-3-pyridinyl]-N-(1-methylpiperidin-4-yl)imidazo[1,2-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 53358067 |
| Molecular Formula | C21H29N7 |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | 3-[6-(butylamino)-3-pyridinyl]-N-(1-methylpiperidin-4-yl)imidazo[1,2-b]pyridazin-6-amine |
| SMILES | CCCCNc1ccc(-c2cnc3ccc(NC4CCN(C)CC4)nn23)cn1 |
| InChI | InChI=1S/C21H29N7/c1-3-4-11-22-19-6-5-16(14-23-19)18-15-24-21-8-7-20(26-28(18)21)25-17-9-12-27(2)13-10-17/h5-8,14-15,17H,3-4,9-13H2,1-2H3,(H,22,23)(H,25,26) |
| InChIKey | VPHYAWVOBAGENA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 70.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|