C16H21ClO5 — CID 53358200
(7R,8S,8aS)-5-chloro-7,8-dihydroxy-3-[(E,3S,4S)-4-hydroxy-3-methylpent-1-enyl]-7-methyl-8,8a-dihydro-1H-isochromen-6-one (PubChem CID 53358200) has the molecular formula C16H21ClO5 and a molecular weight of 328.79 g/mol. Its IUPAC name is (7R,8S,8aS)-5-chloro-7,8-dihydroxy-3-[(E,3S,4S)-4-hydroxy-3-methylpent-1-enyl]-7-methyl-8,8a-dihydro-1H-isochromen-6-one.
| Compound Name | (7R,8S,8aS)-5-chloro-7,8-dihydroxy-3-[(E,3S,4S)-4-hydroxy-3-methylpent-1-enyl]-7-methyl-8,8a-dihydro-1H-isochromen-6-one |
|---|---|
| PubChem CID | 53358200 |
| Molecular Formula | C16H21ClO5 |
| Molecular Weight | 328.79 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | (7R,8S,8aS)-5-chloro-7,8-dihydroxy-3-[(E,3S,4S)-4-hydroxy-3-methylpent-1-enyl]-7-methyl-8,8a-dihydro-1H-isochromen-6-one |
| SMILES | C[C@H](O)[C@@H](C)/C=C/C1=CC2=C(Cl)C(=O)[C@](C)(O)[C@@H](O)[C@@H]2CO1 |
| InChI | InChI=1S/C16H21ClO5/c1-8(9(2)18)4-5-10-6-11-12(7-22-10)14(19)16(3,21)15(20)13(11)17/h4-6,8-9,12,14,18-19,21H,7H2,1-3H3/b5-4+/t8-,9-,12+,14-,16+/m0/s1 |
| InChIKey | HYQLBUHERBRGKE-HKOMCDGQSA-N |
| XLogP | 1.28 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.79 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|