C28H27ClN8O3 — CID 53358697
methyl N-[(11E,14S)-14-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-16,18-diazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,11,15-hexaen-5-yl]carbamate (PubChem CID 53358697) has the molecular formula C28H27ClN8O3 and a molecular weight of 559.03 g/mol. Its IUPAC name is methyl N-[(11E,14S)-14-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-16,18-diazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,11,15-hexaen-5-yl]carbamate.
| Compound Name | methyl N-[(11E,14S)-14-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-16,18-diazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,11,15-hexaen-5-yl]carbamate |
|---|---|
| PubChem CID | 53358697 |
| Molecular Formula | C28H27ClN8O3 |
| Molecular Weight | 559.03 g/mol |
| Exact Mass | 558.19 |
| IUPAC Name | methyl N-[(11E,14S)-14-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-16,18-diazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,11,15-hexaen-5-yl]carbamate |
| SMILES | COC(=O)Nc1ccc2c(c1)CCC/C=C/C[C@H](NC(=O)/C=C/c1cc(Cl)ccc1-n1cnnn1)c1ncc-2[nH]1 |
| InChI | InChI=1S/C28H27ClN8O3/c1-40-28(39)32-21-10-11-22-18(15-21)6-4-2-3-5-7-23(27-30-16-24(22)34-27)33-26(38)13-8-19-14-20(29)9-12-25(19)37-17-31-35-36-37/h3,5,8-17,23H,2,4,6-7H2,1H3,(H,30,34)(H,32,39)(H,33,38)/b5-3+,13-8+/t23-/m0/s1 |
| InChIKey | MMOCHVVLIBSUIZ-AQVLRBOBSA-N |
| XLogP | 5.04 |
| TPSA | 139.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.03 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|