C17H24FeN2O3 — CID 533593
carbon monoxide;N,N'-dicyclohexylethane-1,2-diimine;iron (PubChem CID 533593) has the molecular formula C17H24FeN2O3 and a molecular weight of 360.24 g/mol. Its IUPAC name is carbon monoxide;N,N'-dicyclohexylethane-1,2-diimine;iron.
| Compound Name | carbon monoxide;N,N'-dicyclohexylethane-1,2-diimine;iron |
|---|---|
| PubChem CID | 533593 |
| Molecular Formula | C17H24FeN2O3 |
| Molecular Weight | 360.24 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | carbon monoxide;N,N'-dicyclohexylethane-1,2-diimine;iron |
| SMILES | C(/C=N/C1CCCCC1)=N\C1CCCCC1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Fe] |
| InChI | InChI=1S/C14H24N2.3CO.Fe/c1-3-7-13(8-4-1)15-11-12-16-14-9-5-2-6-10-14;3*1-2;/h11-14H,1-10H2;;;;/b15-11+,16-12+;;;; |
| InChIKey | GXYCKYFKCBHZCJ-VCOCBPDDSA-N |
| XLogP | 3.68 |
| TPSA | 84.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.24 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|