C11H12FNO4 — CID 53359512
(3S,4R)-6-fluoro-3-methyl-4-(nitromethyl)-3,4-dihydro-2H-chromen-2-ol (PubChem CID 53359512) has the molecular formula C11H12FNO4 and a molecular weight of 241.22 g/mol. Its IUPAC name is (3S,4R)-6-fluoro-3-methyl-4-(nitromethyl)-3,4-dihydro-2H-chromen-2-ol.
| Compound Name | (3S,4R)-6-fluoro-3-methyl-4-(nitromethyl)-3,4-dihydro-2H-chromen-2-ol |
|---|---|
| PubChem CID | 53359512 |
| Molecular Formula | C11H12FNO4 |
| Molecular Weight | 241.22 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | (3S,4R)-6-fluoro-3-methyl-4-(nitromethyl)-3,4-dihydro-2H-chromen-2-ol |
| SMILES | C[C@@H]1C(O)Oc2ccc(F)cc2[C@@H]1C[N+](=O)[O-] |
| InChI | InChI=1S/C11H12FNO4/c1-6-9(5-13(15)16)8-4-7(12)2-3-10(8)17-11(6)14/h2-4,6,9,11,14H,5H2,1H3/t6-,9+,11?/m0/s1 |
| InChIKey | SMCPVWZDDYSQMD-NOZFUZGUSA-N |
| XLogP | 1.53 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.22 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|