C17H18O3 — CID 53359651
methyl (1R,2R,5S,7R)-6-oxo-2-phenyltricyclo[3.3.1.02,7]nonane-5-carboxylate (PubChem CID 53359651) has the molecular formula C17H18O3 and a molecular weight of 270.33 g/mol. Its IUPAC name is methyl (1R,2R,5S,7R)-6-oxo-2-phenyltricyclo[3.3.1.02,7]nonane-5-carboxylate.
| Compound Name | methyl (1R,2R,5S,7R)-6-oxo-2-phenyltricyclo[3.3.1.02,7]nonane-5-carboxylate |
|---|---|
| PubChem CID | 53359651 |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | methyl (1R,2R,5S,7R)-6-oxo-2-phenyltricyclo[3.3.1.02,7]nonane-5-carboxylate |
| SMILES | COC(=O)[C@]12CC[C@@]3(c4ccccc4)[C@H](C[C@H]3C1=O)C2 |
| InChI | InChI=1S/C17H18O3/c1-20-15(19)16-7-8-17(11-5-3-2-4-6-11)12(10-16)9-13(17)14(16)18/h2-6,12-13H,7-10H2,1H3/t12-,13+,16+,17-/m1/s1 |
| InChIKey | LTXIXKQBAYSIPK-OSRSDYAFSA-N |
| XLogP | 2.49 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|