C22H28O5 — CID 53359709
(6S,7S,8S)-3-methoxy-6,7-dimethyl-8-(3,4,5-trimethoxyphenyl)-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 53359709) has the molecular formula C22H28O5 and a molecular weight of 372.46 g/mol. Its IUPAC name is (6S,7S,8S)-3-methoxy-6,7-dimethyl-8-(3,4,5-trimethoxyphenyl)-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | (6S,7S,8S)-3-methoxy-6,7-dimethyl-8-(3,4,5-trimethoxyphenyl)-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 53359709 |
| Molecular Formula | C22H28O5 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | (6S,7S,8S)-3-methoxy-6,7-dimethyl-8-(3,4,5-trimethoxyphenyl)-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | COc1cc2c(cc1O)[C@H](c1cc(OC)c(OC)c(OC)c1)[C@@H](C)[C@@H](C)C2 |
| InChI | InChI=1S/C22H28O5/c1-12-7-14-8-18(24-3)17(23)11-16(14)21(13(12)2)15-9-19(25-4)22(27-6)20(10-15)26-5/h8-13,21,23H,7H2,1-6H3/t12-,13-,21-/m0/s1 |
| InChIKey | URJIMCPRAROPBM-BYVOGVQKSA-N |
| XLogP | 4.39 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |