C26H33BF2N2O4 — CID 53359885
2,2-difluoro-8-[4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 53359885) has the molecular formula C26H33BF2N2O4 and a molecular weight of 486.37 g/mol. Its IUPAC name is 2,2-difluoro-8-[4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 2,2-difluoro-8-[4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 53359885 |
| Molecular Formula | C26H33BF2N2O4 |
| Molecular Weight | 486.37 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | 2,2-difluoro-8-[4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | COCCOCCOCCOc1ccc(C2=C3C(C)=CC(C)=[N+]3[B-](F)(F)n3c(C)cc(C)c32)cc1 |
| InChI | InChI=1S/C26H33BF2N2O4/c1-18-16-20(3)30-25(18)24(26-19(2)17-21(4)31(26)27(30,28)29)22-6-8-23(9-7-22)35-15-14-34-13-12-33-11-10-32-5/h6-9,16-17H,10-15H2,1-5H3 |
| InChIKey | ANDLVCLJSUORJB-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 44.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.37 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|