C51H63N3O6Si3 — CID 53360376
[4-[5-[3,5-bis[3-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-1,2-oxazol-5-yl]phenyl]-1,2-oxazol-3-yl]phenoxy]-tert-butyl-dimethylsilane (PubChem CID 53360376) has the molecular formula C51H63N3O6Si3 and a molecular weight of 898.34 g/mol. Its IUPAC name is [4-[5-[3,5-bis[3-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-1,2-oxazol-5-yl]phenyl]-1,2-oxazol-3-yl]phenoxy]-tert-butyl-dimethylsilane.
| Compound Name | [4-[5-[3,5-bis[3-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-1,2-oxazol-5-yl]phenyl]-1,2-oxazol-3-yl]phenoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 53360376 |
| Molecular Formula | C51H63N3O6Si3 |
| Molecular Weight | 898.34 g/mol |
| Exact Mass | 897.40 |
| IUPAC Name | [4-[5-[3,5-bis[3-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-1,2-oxazol-5-yl]phenyl]-1,2-oxazol-3-yl]phenoxy]-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(-c2cc(-c3cc(-c4cc(-c5ccc(O[Si](C)(C)C(C)(C)C)cc5)no4)cc(-c4cc(-c5ccc(O[Si](C)(C)C(C)(C)C)cc5)no4)c3)on2)cc1 |
| InChI | InChI=1S/C51H63N3O6Si3/c1-49(2,3)61(10,11)58-40-22-16-34(17-23-40)43-31-46(55-52-43)37-28-38(47-32-44(53-56-47)35-18-24-41(25-19-35)59-62(12,13)50(4,5)6)30-39(29-37)48-33-45(54-57-48)36-20-26-42(27-21-36)60-63(14,15)51(7,8)9/h16-33H,1-15H3 |
| InChIKey | DGSNPBRQTHJNPW-UHFFFAOYSA-N |
| XLogP | 15.80 |
| TPSA | 105.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 898.34 |
| LogP ≤ 5 | 15.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|