C19H29F3INO2Si — CID 53360447
1-[(9R)-9-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1-iodo-6,7,8,9-tetrahydro-5H-pyrrolo[1,2-a]azepin-3-yl]-2,2,2-trifluoroethanone (PubChem CID 53360447) has the molecular formula C19H29F3INO2Si and a molecular weight of 515.43 g/mol. Its IUPAC name is 1-[(9R)-9-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1-iodo-6,7,8,9-tetrahydro-5H-pyrrolo[1,2-a]azepin-3-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[(9R)-9-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1-iodo-6,7,8,9-tetrahydro-5H-pyrrolo[1,2-a]azepin-3-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 53360447 |
| Molecular Formula | C19H29F3INO2Si |
| Molecular Weight | 515.43 g/mol |
| Exact Mass | 515.10 |
| IUPAC Name | 1-[(9R)-9-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1-iodo-6,7,8,9-tetrahydro-5H-pyrrolo[1,2-a]azepin-3-yl]-2,2,2-trifluoroethanone |
| SMILES | CC(C)(C)[Si](C)(C)OCC[C@H]1CCCCn2c(C(=O)C(F)(F)F)cc(I)c21 |
| InChI | InChI=1S/C19H29F3INO2Si/c1-18(2,3)27(4,5)26-11-9-13-8-6-7-10-24-15(12-14(23)16(13)24)17(25)19(20,21)22/h12-13H,6-11H2,1-5H3/t13-/m1/s1 |
| InChIKey | KGZXNKFQKBMGQF-CYBMUJFWSA-N |
| XLogP | 6.52 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.43 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|