C22H34O6 — CID 53360481
(1R,2S,5R,6S)-1-[(1S,2E,5R,6E)-1,5-dihydroxy-3,7,11-trimethyldodeca-2,6,10-trienyl]-4-(hydroxymethyl)-7-oxabicyclo[4.1.0]hept-3-ene-2,5-diol (PubChem CID 53360481) has the molecular formula C22H34O6 and a molecular weight of 394.51 g/mol. Its IUPAC name is (1R,2S,5R,6S)-1-[(1S,2E,5R,6E)-1,5-dihydroxy-3,7,11-trimethyldodeca-2,6,10-trienyl]-4-(hydroxymethyl)-7-oxabicyclo[4.1.0]hept-3-ene-2,5-diol.
| Compound Name | (1R,2S,5R,6S)-1-[(1S,2E,5R,6E)-1,5-dihydroxy-3,7,11-trimethyldodeca-2,6,10-trienyl]-4-(hydroxymethyl)-7-oxabicyclo[4.1.0]hept-3-ene-2,5-diol |
|---|---|
| PubChem CID | 53360481 |
| Molecular Formula | C22H34O6 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | (1R,2S,5R,6S)-1-[(1S,2E,5R,6E)-1,5-dihydroxy-3,7,11-trimethyldodeca-2,6,10-trienyl]-4-(hydroxymethyl)-7-oxabicyclo[4.1.0]hept-3-ene-2,5-diol |
| SMILES | CC(C)=CCC/C(C)=C/[C@H](O)C/C(C)=C/[C@H](O)[C@]12O[C@H]1[C@H](O)C(CO)=C[C@@H]2O |
| InChI | InChI=1S/C22H34O6/c1-13(2)6-5-7-14(3)8-17(24)9-15(4)10-18(25)22-19(26)11-16(12-23)20(27)21(22)28-22/h6,8,10-11,17-21,23-27H,5,7,9,12H2,1-4H3/b14-8+,15-10+/t17-,18-,19-,20+,21-,22+/m0/s1 |
| InChIKey | GIACKNPQRFVICY-XMCVGHNMSA-N |
| XLogP | 1.53 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|