C26H33N3O3 — CID 53361011
(E)-N-hydroxy-3-[4-[[2-[2-(2-hydroxypropan-2-yl)-1H-indol-3-yl]ethyl-propan-2-ylamino]methyl]phenyl]prop-2-enamide (PubChem CID 53361011) has the molecular formula C26H33N3O3 and a molecular weight of 435.57 g/mol. Its IUPAC name is (E)-N-hydroxy-3-[4-[[2-[2-(2-hydroxypropan-2-yl)-1H-indol-3-yl]ethyl-propan-2-ylamino]methyl]phenyl]prop-2-enamide.
| Compound Name | (E)-N-hydroxy-3-[4-[[2-[2-(2-hydroxypropan-2-yl)-1H-indol-3-yl]ethyl-propan-2-ylamino]methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 53361011 |
| Molecular Formula | C26H33N3O3 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | (E)-N-hydroxy-3-[4-[[2-[2-(2-hydroxypropan-2-yl)-1H-indol-3-yl]ethyl-propan-2-ylamino]methyl]phenyl]prop-2-enamide |
| SMILES | CC(C)N(CCc1c(C(C)(C)O)[nH]c2ccccc12)Cc1ccc(/C=C/C(=O)NO)cc1 |
| InChI | InChI=1S/C26H33N3O3/c1-18(2)29(17-20-11-9-19(10-12-20)13-14-24(30)28-32)16-15-22-21-7-5-6-8-23(21)27-25(22)26(3,4)31/h5-14,18,27,31-32H,15-17H2,1-4H3,(H,28,30)/b14-13+ |
| InChIKey | MRFBLUAPKSWGQC-BUHFOSPRSA-N |
| XLogP | 4.37 |
| TPSA | 88.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|