C21H29NO5S — CID 53361061
[(8S,9S,13S,14S,17S)-17-acetyl-2-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] sulfamate (PubChem CID 53361061) has the molecular formula C21H29NO5S and a molecular weight of 407.53 g/mol. Its IUPAC name is [(8S,9S,13S,14S,17S)-17-acetyl-2-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] sulfamate.
| Compound Name | [(8S,9S,13S,14S,17S)-17-acetyl-2-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] sulfamate |
|---|---|
| PubChem CID | 53361061 |
| Molecular Formula | C21H29NO5S |
| Molecular Weight | 407.53 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | [(8S,9S,13S,14S,17S)-17-acetyl-2-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] sulfamate |
| SMILES | COc1cc2c(cc1OS(N)(=O)=O)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](C(C)=O)CC[C@@H]12 |
| InChI | InChI=1S/C21H29NO5S/c1-12(23)17-6-7-18-15-5-4-13-10-20(27-28(22,24)25)19(26-3)11-16(13)14(15)8-9-21(17,18)2/h10-11,14-15,17-18H,4-9H2,1-3H3,(H2,22,24,25)/t14-,15+,17+,18-,21+/m0/s1 |
| InChIKey | QWVICRLYVWMTNQ-BSEUJLJWSA-N |
| XLogP | 3.34 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.53 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |