C22H31NO5S — CID 53361062
[(8S,9S,13R,14S,17R)-2-methoxy-13-methyl-17-(2-oxopropyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] sulfamate (PubChem CID 53361062) has the molecular formula C22H31NO5S and a molecular weight of 421.56 g/mol. Its IUPAC name is [(8S,9S,13R,14S,17R)-2-methoxy-13-methyl-17-(2-oxopropyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] sulfamate.
| Compound Name | [(8S,9S,13R,14S,17R)-2-methoxy-13-methyl-17-(2-oxopropyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] sulfamate |
|---|---|
| PubChem CID | 53361062 |
| Molecular Formula | C22H31NO5S |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | [(8S,9S,13R,14S,17R)-2-methoxy-13-methyl-17-(2-oxopropyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] sulfamate |
| SMILES | COc1cc2c(cc1OS(N)(=O)=O)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](CC(C)=O)CC[C@@H]12 |
| InChI | InChI=1S/C22H31NO5S/c1-13(24)10-15-5-7-19-17-6-4-14-11-21(28-29(23,25)26)20(27-3)12-18(14)16(17)8-9-22(15,19)2/h11-12,15-17,19H,4-10H2,1-3H3,(H2,23,25,26)/t15-,16+,17-,19+,22-/m1/s1 |
| InChIKey | PCRSJJPGEUKZHF-QGAUHXJISA-N |
| XLogP | 3.73 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |