C20H17N3O3S — CID 53361673
[(2-phenyl-1,3-thiazol-4-yl)-(3,4,5-trimethoxyphenyl)methylidene]cyanamide (PubChem CID 53361673) has the molecular formula C20H17N3O3S and a molecular weight of 379.44 g/mol. Its IUPAC name is [(2-phenyl-1,3-thiazol-4-yl)-(3,4,5-trimethoxyphenyl)methylidene]cyanamide.
| Compound Name | [(2-phenyl-1,3-thiazol-4-yl)-(3,4,5-trimethoxyphenyl)methylidene]cyanamide |
|---|---|
| PubChem CID | 53361673 |
| Molecular Formula | C20H17N3O3S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | [(2-phenyl-1,3-thiazol-4-yl)-(3,4,5-trimethoxyphenyl)methylidene]cyanamide |
| SMILES | COc1cc(/C(=N/C#N)c2csc(-c3ccccc3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C20H17N3O3S/c1-24-16-9-14(10-17(25-2)19(16)26-3)18(22-12-21)15-11-27-20(23-15)13-7-5-4-6-8-13/h4-11H,1-3H3/b22-18- |
| InChIKey | DYMMGCVPVWRVOU-PYCFMQQDSA-N |
| XLogP | 4.15 |
| TPSA | 76.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|