About 1-O-ethyl 3-O-methyl 2-methoxyiminopropanedioate
1-O-ethyl 3-O-methyl 2-methoxyiminopropanedioate (PubChem CID 533617) has the molecular formula C7H11NO5
and a molecular weight of 189.17 g/mol. Its IUPAC name is 1-O-ethyl 3-O-methyl 2-methoxyiminopropanedioate.
Molecular Properties
| Compound Name | 1-O-ethyl 3-O-methyl 2-methoxyiminopropanedioate |
| PubChem CID | 533617 |
| Molecular Formula | C7H11NO5 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | 1-O-ethyl 3-O-methyl 2-methoxyiminopropanedioate |
| SMILES | CCOC(=O)C(=NOC)C(=O)OC |
| InChI | InChI=1S/C7H11NO5/c1-4-13-7(10)5(8-12-3)6(9)11-2/h4H2,1-3H3 |
| InChIKey | SCHSPILZFJKGQZ-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-O-ethyl 3-O-methyl 2-methoxyiminopropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-ethyl 3-O-methyl 2-methoxyiminopropanedioate?
The IUPAC name of 1-O-ethyl 3-O-methyl 2-methoxyiminopropanedioate (CID 533617) is 1-O-ethyl 3-O-methyl 2-methoxyiminopropanedioate.
What is the SMILES notation for 1-O-ethyl 3-O-methyl 2-methoxyiminopropanedioate?
The canonical SMILES for 1-O-ethyl 3-O-methyl 2-methoxyiminopropanedioate is CCOC(=O)C(=NOC)C(=O)OC.
What is the InChIKey of 1-O-ethyl 3-O-methyl 2-methoxyiminopropanedioate?
The InChIKey is SCHSPILZFJKGQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO5/c1-4-13-7(10)5(8-12-3)6(9)11-2/h4H2,1-3H3.
What are the key properties of 1-O-ethyl 3-O-methyl 2-methoxyiminopropanedioate?
1-O-ethyl 3-O-methyl 2-methoxyiminopropanedioate has a molecular weight of 189.17 g/mol, XLogP of -0.28, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-ethyl 3-O-methyl 2-methoxyiminopropanedioate is sourced from PubChem (CID 533617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).