C23H16N2O3S — CID 53361724
8-anilino-6-thiophen-3-yl-3,4-dihydro-2H-phenanthridine-1,7,10-trione (PubChem CID 53361724) has the molecular formula C23H16N2O3S and a molecular weight of 400.46 g/mol. Its IUPAC name is 8-anilino-6-thiophen-3-yl-3,4-dihydro-2H-phenanthridine-1,7,10-trione.
| Compound Name | 8-anilino-6-thiophen-3-yl-3,4-dihydro-2H-phenanthridine-1,7,10-trione |
|---|---|
| PubChem CID | 53361724 |
| Molecular Formula | C23H16N2O3S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | 8-anilino-6-thiophen-3-yl-3,4-dihydro-2H-phenanthridine-1,7,10-trione |
| SMILES | O=C1CCCc2nc(-c3ccsc3)c3c(c21)C(=O)C=C(Nc1ccccc1)C3=O |
| InChI | InChI=1S/C23H16N2O3S/c26-17-8-4-7-15-19(17)20-18(27)11-16(24-14-5-2-1-3-6-14)23(28)21(20)22(25-15)13-9-10-29-12-13/h1-3,5-6,9-12,24H,4,7-8H2 |
| InChIKey | COYADXMNIQIWFN-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|