C36H34N6O — CID 53362013
N-[(1S)-1-(3-cyclopropylphenyl)ethyl]-2,3-dimethyl-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]indole-5-carboxamide (PubChem CID 53362013) has the molecular formula C36H34N6O and a molecular weight of 566.71 g/mol. Its IUPAC name is N-[(1S)-1-(3-cyclopropylphenyl)ethyl]-2,3-dimethyl-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]indole-5-carboxamide.
| Compound Name | N-[(1S)-1-(3-cyclopropylphenyl)ethyl]-2,3-dimethyl-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]indole-5-carboxamide |
|---|---|
| PubChem CID | 53362013 |
| Molecular Formula | C36H34N6O |
| Molecular Weight | 566.71 g/mol |
| Exact Mass | 566.28 |
| IUPAC Name | N-[(1S)-1-(3-cyclopropylphenyl)ethyl]-2,3-dimethyl-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]indole-5-carboxamide |
| SMILES | Cc1c(C)n(Cc2ccc(-c3ccccc3-c3nn[nH]n3)cc2)c2ccc(C(=O)N[C@@H](C)c3cccc(C4CC4)c3)cc12 |
| InChI | InChI=1S/C36H34N6O/c1-22-24(3)42(21-25-11-13-27(14-12-25)31-9-4-5-10-32(31)35-38-40-41-39-35)34-18-17-30(20-33(22)34)36(43)37-23(2)28-7-6-8-29(19-28)26-15-16-26/h4-14,17-20,23,26H,15-16,21H2,1-3H3,(H,37,43)(H,38,39,40,41)/t23-/m0/s1 |
| InChIKey | NOIKDSYWJSLLAU-QHCPKHFHSA-N |
| XLogP | 7.52 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.71 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|