C16H19NO — CID 53362162
2,2,7-trimethyl-1,3,4,10-tetrahydroacridin-9-one (PubChem CID 53362162) has the molecular formula C16H19NO and a molecular weight of 241.33 g/mol. Its IUPAC name is 2,2,7-trimethyl-1,3,4,10-tetrahydroacridin-9-one.
| Compound Name | 2,2,7-trimethyl-1,3,4,10-tetrahydroacridin-9-one |
|---|---|
| PubChem CID | 53362162 |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 2,2,7-trimethyl-1,3,4,10-tetrahydroacridin-9-one |
| SMILES | Cc1ccc2[nH]c3c(c(=O)c2c1)CC(C)(C)CC3 |
| InChI | InChI=1S/C16H19NO/c1-10-4-5-13-11(8-10)15(18)12-9-16(2,3)7-6-14(12)17-13/h4-5,8H,6-7,9H2,1-3H3,(H,17,18) |
| InChIKey | ULCVTKGPWHHVFP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |